C21H23FN4O — CID 78806750
N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-3-(4-fluorophenyl)propanamide (PubChem CID 78806750) has the molecular formula C21H23FN4O and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-3-(4-fluorophenyl)propanamide.
| Compound Name | N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-3-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 78806750 |
| Molecular Formula | C21H23FN4O |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-3-(4-fluorophenyl)propanamide |
| SMILES | CN(C)c1ccc(Cn2nccc2NC(=O)CCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H23FN4O/c1-25(2)19-10-5-17(6-11-19)15-26-20(13-14-23-26)24-21(27)12-7-16-3-8-18(22)9-4-16/h3-6,8-11,13-14H,7,12,15H2,1-2H3,(H,24,27) |
| InChIKey | FVIURULWQWOJJT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|