C23H27N5O2 — CID 78806761
N-[4-[[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]amino]-4-oxobutyl]benzamide (PubChem CID 78806761) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[4-[[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]amino]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 78806761 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | N-[4-[[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]amino]-4-oxobutyl]benzamide |
| SMILES | CN(C)c1ccc(Cn2nccc2NC(=O)CCCNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H27N5O2/c1-27(2)20-12-10-18(11-13-20)17-28-21(14-16-25-28)26-22(29)9-6-15-24-23(30)19-7-4-3-5-8-19/h3-5,7-8,10-14,16H,6,9,15,17H2,1-2H3,(H,24,30)(H,26,29) |
| InChIKey | VJASCUXYYRIAII-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|