C23H26N8O — CID 86883844
N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-4-(5-phenyltetrazol-2-yl)butanamide (PubChem CID 86883844) has the molecular formula C23H26N8O and a molecular weight of 430.52 g/mol. Its IUPAC name is N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-4-(5-phenyltetrazol-2-yl)butanamide.
| Compound Name | N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-4-(5-phenyltetrazol-2-yl)butanamide |
|---|---|
| PubChem CID | 86883844 |
| Molecular Formula | C23H26N8O |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | N-[2-[[4-(dimethylamino)phenyl]methyl]pyrazol-3-yl]-4-(5-phenyltetrazol-2-yl)butanamide |
| SMILES | CN(C)c1ccc(Cn2nccc2NC(=O)CCCn2nnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H26N8O/c1-29(2)20-12-10-18(11-13-20)17-30-21(14-15-24-30)25-22(32)9-6-16-31-27-23(26-28-31)19-7-4-3-5-8-19/h3-5,7-8,10-15H,6,9,16-17H2,1-2H3,(H,25,32) |
| InChIKey | NLNPQUHCTXAPNE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|