C15H13ClN6O2S — CID 78846210
N'-[2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-1H-pyrrole-2-carbohydrazide (PubChem CID 78846210) has the molecular formula C15H13ClN6O2S and a molecular weight of 376.83 g/mol. Its IUPAC name is N'-[2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-1H-pyrrole-2-carbohydrazide.
| Compound Name | N'-[2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 78846210 |
| Molecular Formula | C15H13ClN6O2S |
| Molecular Weight | 376.83 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | N'-[2-[[4-(3-chlorophenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(CSc1nncn1-c1cccc(Cl)c1)NNC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C15H13ClN6O2S/c16-10-3-1-4-11(7-10)22-9-18-21-15(22)25-8-13(23)19-20-14(24)12-5-2-6-17-12/h1-7,9,17H,8H2,(H,19,23)(H,20,24) |
| InChIKey | OTIYQKFFHDOAQF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.83 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|