C23H28F2N2O3 — CID 78848378
3-[4-(difluoromethoxy)phenyl]-1-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]propan-1-one (PubChem CID 78848378) has the molecular formula C23H28F2N2O3 and a molecular weight of 418.48 g/mol. Its IUPAC name is 3-[4-(difluoromethoxy)phenyl]-1-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-[4-(difluoromethoxy)phenyl]-1-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 78848378 |
| Molecular Formula | C23H28F2N2O3 |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 3-[4-(difluoromethoxy)phenyl]-1-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]propan-1-one |
| SMILES | CCOc1ccc(CN2CCN(C(=O)CCc3ccc(OC(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H28F2N2O3/c1-2-29-20-8-5-19(6-9-20)17-26-13-15-27(16-14-26)22(28)12-7-18-3-10-21(11-4-18)30-23(24)25/h3-6,8-11,23H,2,7,12-17H2,1H3 |
| InChIKey | QCQDSTJZUDIHJA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |