C22H30F2N2O3 — CID 78851506
3-cyclopentyl-1-[4-[3-[4-(difluoromethoxy)phenyl]propanoyl]piperazin-1-yl]propan-1-one (PubChem CID 78851506) has the molecular formula C22H30F2N2O3 and a molecular weight of 408.49 g/mol. Its IUPAC name is 3-cyclopentyl-1-[4-[3-[4-(difluoromethoxy)phenyl]propanoyl]piperazin-1-yl]propan-1-one.
| Compound Name | 3-cyclopentyl-1-[4-[3-[4-(difluoromethoxy)phenyl]propanoyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 78851506 |
| Molecular Formula | C22H30F2N2O3 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 3-cyclopentyl-1-[4-[3-[4-(difluoromethoxy)phenyl]propanoyl]piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCc1ccc(OC(F)F)cc1)N1CCN(C(=O)CCC2CCCC2)CC1 |
| InChI | InChI=1S/C22H30F2N2O3/c23-22(24)29-19-9-5-18(6-10-19)8-12-21(28)26-15-13-25(14-16-26)20(27)11-7-17-3-1-2-4-17/h5-6,9-10,17,22H,1-4,7-8,11-16H2 |
| InChIKey | VZHVVFBKMFXCTR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |