C13H11N5O3 — CID 78848489
5-(furan-2-yl)-N'-(1H-pyrrole-2-carbonyl)-1H-pyrazole-3-carbohydrazide (PubChem CID 78848489) has the molecular formula C13H11N5O3 and a molecular weight of 285.26 g/mol. Its IUPAC name is 5-(furan-2-yl)-N'-(1H-pyrrole-2-carbonyl)-1H-pyrazole-3-carbohydrazide.
| Compound Name | 5-(furan-2-yl)-N'-(1H-pyrrole-2-carbonyl)-1H-pyrazole-3-carbohydrazide |
|---|---|
| PubChem CID | 78848489 |
| Molecular Formula | C13H11N5O3 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 5-(furan-2-yl)-N'-(1H-pyrrole-2-carbonyl)-1H-pyrazole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc[nH]1)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C13H11N5O3/c19-12(8-3-1-5-14-8)17-18-13(20)10-7-9(15-16-10)11-4-2-6-21-11/h1-7,14H,(H,15,16)(H,17,19)(H,18,20) |
| InChIKey | CQSZPUBBPODDAM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|