C13H12N2O4S — CID 788495
2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate (PubChem CID 788495) has the molecular formula C13H12N2O4S and a molecular weight of 292.32 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate.
| Compound Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate |
|---|---|
| PubChem CID | 788495 |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-5-yl)ethyl 3-nitrobenzoate |
| SMILES | Cc1ncsc1CCOC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12N2O4S/c1-9-12(20-8-14-9)5-6-19-13(16)10-3-2-4-11(7-10)15(17)18/h2-4,7-8H,5-6H2,1H3 |
| InChIKey | FKLKQOBTXZLDQU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|