C16H20N2O3 — CID 78850726
(1-methylpyrazol-4-yl)methyl 3-(3,4-dimethylphenoxy)propanoate (PubChem CID 78850726) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (1-methylpyrazol-4-yl)methyl 3-(3,4-dimethylphenoxy)propanoate.
| Compound Name | (1-methylpyrazol-4-yl)methyl 3-(3,4-dimethylphenoxy)propanoate |
|---|---|
| PubChem CID | 78850726 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (1-methylpyrazol-4-yl)methyl 3-(3,4-dimethylphenoxy)propanoate |
| SMILES | Cc1ccc(OCCC(=O)OCc2cnn(C)c2)cc1C |
| InChI | InChI=1S/C16H20N2O3/c1-12-4-5-15(8-13(12)2)20-7-6-16(19)21-11-14-9-17-18(3)10-14/h4-5,8-10H,6-7,11H2,1-3H3 |
| InChIKey | HKHYLJAKIAJBTJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |