C27H24N2O4 — CID 78852178
4-[[[(E)-3-(1-benzofuran-2-yl)prop-2-enoyl]-(furan-2-ylmethyl)amino]methyl]-N-cyclopropylbenzamide (PubChem CID 78852178) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is 4-[[[(E)-3-(1-benzofuran-2-yl)prop-2-enoyl]-(furan-2-ylmethyl)amino]methyl]-N-cyclopropylbenzamide.
| Compound Name | 4-[[[(E)-3-(1-benzofuran-2-yl)prop-2-enoyl]-(furan-2-ylmethyl)amino]methyl]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 78852178 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 4-[[[(E)-3-(1-benzofuran-2-yl)prop-2-enoyl]-(furan-2-ylmethyl)amino]methyl]-N-cyclopropylbenzamide |
| SMILES | O=C(NC1CC1)c1ccc(CN(Cc2ccco2)C(=O)/C=C/c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C27H24N2O4/c30-26(14-13-23-16-21-4-1-2-6-25(21)33-23)29(18-24-5-3-15-32-24)17-19-7-9-20(10-8-19)27(31)28-22-11-12-22/h1-10,13-16,22H,11-12,17-18H2,(H,28,31)/b14-13+ |
| InChIKey | NHBUSIYJQBZOKX-BUHFOSPRSA-N |
| XLogP | 5.16 |
| TPSA | 75.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|