C15H17NO3S — CID 78852303
N-cyclopropyl-5-(methoxymethyl)-N-(thiophen-2-ylmethyl)furan-2-carboxamide (PubChem CID 78852303) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is N-cyclopropyl-5-(methoxymethyl)-N-(thiophen-2-ylmethyl)furan-2-carboxamide.
| Compound Name | N-cyclopropyl-5-(methoxymethyl)-N-(thiophen-2-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 78852303 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-cyclopropyl-5-(methoxymethyl)-N-(thiophen-2-ylmethyl)furan-2-carboxamide |
| SMILES | COCc1ccc(C(=O)N(Cc2cccs2)C2CC2)o1 |
| InChI | InChI=1S/C15H17NO3S/c1-18-10-12-6-7-14(19-12)15(17)16(11-4-5-11)9-13-3-2-8-20-13/h2-3,6-8,11H,4-5,9-10H2,1H3 |
| InChIKey | TVUKUWWNSHAIMS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |