C15H15ClF3N3O2 — CID 78854945
1-(3-chlorophenyl)-N-ethyl-N-(2-hydroxyethyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 78854945) has the molecular formula C15H15ClF3N3O2 and a molecular weight of 361.75 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-ethyl-N-(2-hydroxyethyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-ethyl-N-(2-hydroxyethyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 78854945 |
| Molecular Formula | C15H15ClF3N3O2 |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | 1-(3-chlorophenyl)-N-ethyl-N-(2-hydroxyethyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CCN(CCO)C(=O)c1cnn(-c2cccc(Cl)c2)c1C(F)(F)F |
| InChI | InChI=1S/C15H15ClF3N3O2/c1-2-21(6-7-23)14(24)12-9-20-22(13(12)15(17,18)19)11-5-3-4-10(16)8-11/h3-5,8-9,23H,2,6-7H2,1H3 |
| InChIKey | FTFLBKRFXRVXDY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |