C19H13N3O3 — CID 788570
2-(1,3-dioxoisoindol-2-yl)-N-quinolin-8-ylacetamide (PubChem CID 788570) has the molecular formula C19H13N3O3 and a molecular weight of 331.33 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-quinolin-8-ylacetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-quinolin-8-ylacetamide |
|---|---|
| PubChem CID | 788570 |
| Molecular Formula | C19H13N3O3 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-quinolin-8-ylacetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C19H13N3O3/c23-16(21-15-9-3-5-12-6-4-10-20-17(12)15)11-22-18(24)13-7-1-2-8-14(13)19(22)25/h1-10H,11H2,(H,21,23) |
| InChIKey | PIDWWCQRILDJPQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|