C20H26F3N3O2 — CID 78857533
1-(3-methylpiperidin-1-yl)-2-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]ethanone (PubChem CID 78857533) has the molecular formula C20H26F3N3O2 and a molecular weight of 397.44 g/mol. Its IUPAC name is 1-(3-methylpiperidin-1-yl)-2-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]ethanone.
| Compound Name | 1-(3-methylpiperidin-1-yl)-2-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 78857533 |
| Molecular Formula | C20H26F3N3O2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 1-(3-methylpiperidin-1-yl)-2-[4-[4-(trifluoromethyl)benzoyl]piperazin-1-yl]ethanone |
| SMILES | CC1CCCN(C(=O)CN2CCN(C(=O)c3ccc(C(F)(F)F)cc3)CC2)C1 |
| InChI | InChI=1S/C20H26F3N3O2/c1-15-3-2-8-26(13-15)18(27)14-24-9-11-25(12-10-24)19(28)16-4-6-17(7-5-16)20(21,22)23/h4-7,15H,2-3,8-14H2,1H3 |
| InChIKey | NXMGQMYASRYUGE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |