C11H21F3N2O — CID 78858199
1-(2-ethylhexyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 78858199) has the molecular formula C11H21F3N2O and a molecular weight of 254.30 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(2-ethylhexyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 78858199 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 1-(2-ethylhexyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CCCCC(CC)CNC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C11H21F3N2O/c1-3-5-6-9(4-2)7-15-10(17)16-8-11(12,13)14/h9H,3-8H2,1-2H3,(H2,15,16,17) |
| InChIKey | JEEHMJZXTKUTQK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |