C21H22Cl2N2O3 — CID 78860043
N-benzyl-1-(2,5-dichlorobenzoyl)-N-(2-hydroxyethyl)pyrrolidine-2-carboxamide (PubChem CID 78860043) has the molecular formula C21H22Cl2N2O3 and a molecular weight of 421.32 g/mol. Its IUPAC name is N-benzyl-1-(2,5-dichlorobenzoyl)-N-(2-hydroxyethyl)pyrrolidine-2-carboxamide.
| Compound Name | N-benzyl-1-(2,5-dichlorobenzoyl)-N-(2-hydroxyethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 78860043 |
| Molecular Formula | C21H22Cl2N2O3 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | N-benzyl-1-(2,5-dichlorobenzoyl)-N-(2-hydroxyethyl)pyrrolidine-2-carboxamide |
| SMILES | O=C(C1CCCN1C(=O)c1cc(Cl)ccc1Cl)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C21H22Cl2N2O3/c22-16-8-9-18(23)17(13-16)20(27)25-10-4-7-19(25)21(28)24(11-12-26)14-15-5-2-1-3-6-15/h1-3,5-6,8-9,13,19,26H,4,7,10-12,14H2 |
| InChIKey | POOKADBBJBOAEP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |