C12H14N2OS — CID 78860958
5-methyl-3-(2-pyridin-2-ylethylsulfanylmethyl)-1,2-oxazole (PubChem CID 78860958) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 5-methyl-3-(2-pyridin-2-ylethylsulfanylmethyl)-1,2-oxazole.
| Compound Name | 5-methyl-3-(2-pyridin-2-ylethylsulfanylmethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 78860958 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 5-methyl-3-(2-pyridin-2-ylethylsulfanylmethyl)-1,2-oxazole |
| SMILES | Cc1cc(CSCCc2ccccn2)no1 |
| InChI | InChI=1S/C12H14N2OS/c1-10-8-12(14-15-10)9-16-7-5-11-4-2-3-6-13-11/h2-4,6,8H,5,7,9H2,1H3 |
| InChIKey | MEFYGBQUAIKGDY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|