C17H18ClNO2S — CID 78860421
2-[2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylsulfanyl]ethyl]pyridine (PubChem CID 78860421) has the molecular formula C17H18ClNO2S and a molecular weight of 335.86 g/mol. Its IUPAC name is 2-[2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylsulfanyl]ethyl]pyridine.
| Compound Name | 2-[2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylsulfanyl]ethyl]pyridine |
|---|---|
| PubChem CID | 78860421 |
| Molecular Formula | C17H18ClNO2S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 2-[2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylsulfanyl]ethyl]pyridine |
| SMILES | Clc1cc(CSCCc2ccccn2)cc2c1OCCCO2 |
| InChI | InChI=1S/C17H18ClNO2S/c18-15-10-13(11-16-17(15)21-8-3-7-20-16)12-22-9-5-14-4-1-2-6-19-14/h1-2,4,6,10-11H,3,5,7-9,12H2 |
| InChIKey | FLIMUZJLKKUEEY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|