C12H15ClO3S — CID 43417029
2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylsulfanyl]ethanol (PubChem CID 43417029) has the molecular formula C12H15ClO3S and a molecular weight of 274.77 g/mol. Its IUPAC name is 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylsulfanyl]ethanol.
| Compound Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylsulfanyl]ethanol |
|---|---|
| PubChem CID | 43417029 |
| Molecular Formula | C12H15ClO3S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 2-[(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)methylsulfanyl]ethanol |
| SMILES | OCCSCc1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C12H15ClO3S/c13-10-6-9(8-17-5-2-14)7-11-12(10)16-4-1-3-15-11/h6-7,14H,1-5,8H2 |
| InChIKey | KNLNFXJZKHVXSZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|