C15H21ClO3S — CID 78849205
6-chloro-8-(2-propan-2-yloxyethylsulfanylmethyl)-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 78849205) has the molecular formula C15H21ClO3S and a molecular weight of 316.85 g/mol. Its IUPAC name is 6-chloro-8-(2-propan-2-yloxyethylsulfanylmethyl)-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 6-chloro-8-(2-propan-2-yloxyethylsulfanylmethyl)-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 78849205 |
| Molecular Formula | C15H21ClO3S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 6-chloro-8-(2-propan-2-yloxyethylsulfanylmethyl)-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | CC(C)OCCSCc1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C15H21ClO3S/c1-11(2)17-6-7-20-10-12-8-13(16)15-14(9-12)18-4-3-5-19-15/h8-9,11H,3-7,10H2,1-2H3 |
| InChIKey | UXWBEWCTCJOIGP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|