C19H24F3N3O3S — CID 78861923
3-(7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]propanamide (PubChem CID 78861923) has the molecular formula C19H24F3N3O3S and a molecular weight of 431.48 g/mol. Its IUPAC name is 3-(7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]propanamide.
| Compound Name | 3-(7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]propanamide |
|---|---|
| PubChem CID | 78861923 |
| Molecular Formula | C19H24F3N3O3S |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3-(7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl)-N-[3-(2,2,2-trifluoroethoxy)propyl]propanamide |
| SMILES | CC1CCc2c(sc3nc(CCC(=O)NCCCOCC(F)(F)F)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C19H24F3N3O3S/c1-11-3-4-12-13(9-11)29-18-16(12)17(27)24-14(25-18)5-6-15(26)23-7-2-8-28-10-19(20,21)22/h11H,2-10H2,1H3,(H,23,26)(H,24,25,27) |
| InChIKey | MCXHRFDZECDDIF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|