C24H29N3O4S — CID 92745986
N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]propanamide (PubChem CID 92745986) has the molecular formula C24H29N3O4S and a molecular weight of 455.58 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]propanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]propanamide |
|---|---|
| PubChem CID | 92745986 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-3-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]propanamide |
| SMILES | COc1ccc(CCNC(=O)CCc2nc3sc4c(c3c(=O)[nH]2)CC[C@@H](C)C4)cc1OC |
| InChI | InChI=1S/C24H29N3O4S/c1-14-4-6-16-19(12-14)32-24-22(16)23(29)26-20(27-24)8-9-21(28)25-11-10-15-5-7-17(30-2)18(13-15)31-3/h5,7,13-14H,4,6,8-12H2,1-3H3,(H,25,28)(H,26,27,29)/t14-/m1/s1 |
| InChIKey | SDYXXUARIRRSMV-CQSZACIVSA-N |
| XLogP | 3.42 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |