C25H31N3O4S — CID 92746016
3-[(7R)-7-tert-butyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-N-(3,4-dimethoxyphenyl)propanamide (PubChem CID 92746016) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is 3-[(7R)-7-tert-butyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-N-(3,4-dimethoxyphenyl)propanamide.
| Compound Name | 3-[(7R)-7-tert-butyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-N-(3,4-dimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 92746016 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 3-[(7R)-7-tert-butyl-4-oxo-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-2-yl]-N-(3,4-dimethoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)CCc2nc3sc4c(c3c(=O)[nH]2)CC[C@@H](C(C)(C)C)C4)cc1OC |
| InChI | InChI=1S/C25H31N3O4S/c1-25(2,3)14-6-8-16-19(12-14)33-24-22(16)23(30)27-20(28-24)10-11-21(29)26-15-7-9-17(31-4)18(13-15)32-5/h7,9,13-14H,6,8,10-12H2,1-5H3,(H,26,29)(H,27,28,30)/t14-/m1/s1 |
| InChIKey | MOVXXXCDQKCXNE-CQSZACIVSA-N |
| XLogP | 4.72 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |