C14H16N6O2 — CID 78862709
4-[5-[(4-methoxypyrimidin-2-yl)amino]-2-pyridinyl]piperazin-2-one (PubChem CID 78862709) has the molecular formula C14H16N6O2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 4-[5-[(4-methoxypyrimidin-2-yl)amino]-2-pyridinyl]piperazin-2-one.
| Compound Name | 4-[5-[(4-methoxypyrimidin-2-yl)amino]-2-pyridinyl]piperazin-2-one |
|---|---|
| PubChem CID | 78862709 |
| Molecular Formula | C14H16N6O2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 4-[5-[(4-methoxypyrimidin-2-yl)amino]-2-pyridinyl]piperazin-2-one |
| SMILES | COc1ccnc(Nc2ccc(N3CCNC(=O)C3)nc2)n1 |
| InChI | InChI=1S/C14H16N6O2/c1-22-13-4-5-16-14(19-13)18-10-2-3-11(17-8-10)20-7-6-15-12(21)9-20/h2-5,8H,6-7,9H2,1H3,(H,15,21)(H,16,18,19) |
| InChIKey | CCJWTFOECCCXNT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |