C18H19ClFN3O4S — CID 78866154
1-[3-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]pyridin-2-one (PubChem CID 78866154) has the molecular formula C18H19ClFN3O4S and a molecular weight of 427.89 g/mol. Its IUPAC name is 1-[3-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]pyridin-2-one.
| Compound Name | 1-[3-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]pyridin-2-one |
|---|---|
| PubChem CID | 78866154 |
| Molecular Formula | C18H19ClFN3O4S |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 1-[3-[4-(3-chloro-4-fluorophenyl)sulfonylpiperazin-1-yl]-3-oxopropyl]pyridin-2-one |
| SMILES | O=C(CCn1ccccc1=O)N1CCN(S(=O)(=O)c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H19ClFN3O4S/c19-15-13-14(4-5-16(15)20)28(26,27)23-11-9-22(10-12-23)18(25)6-8-21-7-2-1-3-17(21)24/h1-5,7,13H,6,8-12H2 |
| InChIKey | FEUWSHYVKZTDCO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |