C16H18F3N3O — CID 78868865
5-methyl-N-[3-(trifluoromethyl)cyclohexyl]-1H-indazole-3-carboxamide (PubChem CID 78868865) has the molecular formula C16H18F3N3O and a molecular weight of 325.33 g/mol. Its IUPAC name is 5-methyl-N-[3-(trifluoromethyl)cyclohexyl]-1H-indazole-3-carboxamide.
| Compound Name | 5-methyl-N-[3-(trifluoromethyl)cyclohexyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 78868865 |
| Molecular Formula | C16H18F3N3O |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 5-methyl-N-[3-(trifluoromethyl)cyclohexyl]-1H-indazole-3-carboxamide |
| SMILES | Cc1ccc2[nH]nc(C(=O)NC3CCCC(C(F)(F)F)C3)c2c1 |
| InChI | InChI=1S/C16H18F3N3O/c1-9-5-6-13-12(7-9)14(22-21-13)15(23)20-11-4-2-3-10(8-11)16(17,18)19/h5-7,10-11H,2-4,8H2,1H3,(H,20,23)(H,21,22) |
| InChIKey | QIAKPHGYQFNAFO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |