C20H16FN3O — CID 78869242
3-[2-(4-fluorophenyl)cyclopropyl]-2-(1-methylbenzimidazol-2-yl)-3-oxopropanenitrile (PubChem CID 78869242) has the molecular formula C20H16FN3O and a molecular weight of 333.37 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)cyclopropyl]-2-(1-methylbenzimidazol-2-yl)-3-oxopropanenitrile.
| Compound Name | 3-[2-(4-fluorophenyl)cyclopropyl]-2-(1-methylbenzimidazol-2-yl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 78869242 |
| Molecular Formula | C20H16FN3O |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 3-[2-(4-fluorophenyl)cyclopropyl]-2-(1-methylbenzimidazol-2-yl)-3-oxopropanenitrile |
| SMILES | Cn1c(C(C#N)C(=O)C2CC2c2ccc(F)cc2)nc2ccccc21 |
| InChI | InChI=1S/C20H16FN3O/c1-24-18-5-3-2-4-17(18)23-20(24)16(11-22)19(25)15-10-14(15)12-6-8-13(21)9-7-12/h2-9,14-16H,10H2,1H3 |
| InChIKey | QCULCOXCOCDLBU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |