C19H20N4O2S — CID 78869341
N-[4-[[5-[(4-cyanophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]cyclopropanecarboxamide (PubChem CID 78869341) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-[4-[[5-[(4-cyanophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[5-[(4-cyanophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 78869341 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[4-[[5-[(4-cyanophenyl)methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]cyclopropanecarboxamide |
| SMILES | N#Cc1ccc(Cc2cnc(NC(=O)CCCNC(=O)C3CC3)s2)cc1 |
| InChI | InChI=1S/C19H20N4O2S/c20-11-14-5-3-13(4-6-14)10-16-12-22-19(26-16)23-17(24)2-1-9-21-18(25)15-7-8-15/h3-6,12,15H,1-2,7-10H2,(H,21,25)(H,22,23,24) |
| InChIKey | OACWWYYQWHTIPN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|