C16H22FNO4 — CID 78869482
methyl 2-[2-(3-fluorophenoxy)propanoylamino]-2-methylpentanoate (PubChem CID 78869482) has the molecular formula C16H22FNO4 and a molecular weight of 311.35 g/mol. Its IUPAC name is methyl 2-[2-(3-fluorophenoxy)propanoylamino]-2-methylpentanoate.
| Compound Name | methyl 2-[2-(3-fluorophenoxy)propanoylamino]-2-methylpentanoate |
|---|---|
| PubChem CID | 78869482 |
| Molecular Formula | C16H22FNO4 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | methyl 2-[2-(3-fluorophenoxy)propanoylamino]-2-methylpentanoate |
| SMILES | CCCC(C)(NC(=O)C(C)Oc1cccc(F)c1)C(=O)OC |
| InChI | InChI=1S/C16H22FNO4/c1-5-9-16(3,15(20)21-4)18-14(19)11(2)22-13-8-6-7-12(17)10-13/h6-8,10-11H,5,9H2,1-4H3,(H,18,19) |
| InChIKey | MOOOMAICUJFQOW-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |