C14H17N3S2 — CID 788706
1-(3-ethyl-4-methyl-1,3-thiazol-2-ylidene)-3-(2-methylphenyl)thiourea (PubChem CID 788706) has the molecular formula C14H17N3S2 and a molecular weight of 291.45 g/mol. Its IUPAC name is 1-(3-ethyl-4-methyl-1,3-thiazol-2-ylidene)-3-(2-methylphenyl)thiourea.
| Compound Name | 1-(3-ethyl-4-methyl-1,3-thiazol-2-ylidene)-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 788706 |
| Molecular Formula | C14H17N3S2 |
| Molecular Weight | 291.45 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-(3-ethyl-4-methyl-1,3-thiazol-2-ylidene)-3-(2-methylphenyl)thiourea |
| SMILES | CCn1c(C)csc1=NC(=S)Nc1ccccc1C |
| InChI | InChI=1S/C14H17N3S2/c1-4-17-11(3)9-19-14(17)16-13(18)15-12-8-6-5-7-10(12)2/h5-9H,4H2,1-3H3,(H,15,18) |
| InChIKey | MVELUCXLQISMCG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|