C17H17BrClN3O2 — CID 78874678
N-[2-[(3-bromo-4-methylphenyl)carbamoylamino]ethyl]-2-chlorobenzamide (PubChem CID 78874678) has the molecular formula C17H17BrClN3O2 and a molecular weight of 410.70 g/mol. Its IUPAC name is N-[2-[(3-bromo-4-methylphenyl)carbamoylamino]ethyl]-2-chlorobenzamide.
| Compound Name | N-[2-[(3-bromo-4-methylphenyl)carbamoylamino]ethyl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 78874678 |
| Molecular Formula | C17H17BrClN3O2 |
| Molecular Weight | 410.70 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | N-[2-[(3-bromo-4-methylphenyl)carbamoylamino]ethyl]-2-chlorobenzamide |
| SMILES | Cc1ccc(NC(=O)NCCNC(=O)c2ccccc2Cl)cc1Br |
| InChI | InChI=1S/C17H17BrClN3O2/c1-11-6-7-12(10-14(11)18)22-17(24)21-9-8-20-16(23)13-4-2-3-5-15(13)19/h2-7,10H,8-9H2,1H3,(H,20,23)(H2,21,22,24) |
| InChIKey | RMYULGDALHOHKO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.70 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|