C25H33FN4O2 — CID 78875012
4-[(3-fluoro-4-methoxyphenyl)methyl]-N-[4-(4-methylpiperidin-1-yl)phenyl]piperazine-1-carboxamide (PubChem CID 78875012) has the molecular formula C25H33FN4O2 and a molecular weight of 440.56 g/mol. Its IUPAC name is 4-[(3-fluoro-4-methoxyphenyl)methyl]-N-[4-(4-methylpiperidin-1-yl)phenyl]piperazine-1-carboxamide.
| Compound Name | 4-[(3-fluoro-4-methoxyphenyl)methyl]-N-[4-(4-methylpiperidin-1-yl)phenyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 78875012 |
| Molecular Formula | C25H33FN4O2 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 4-[(3-fluoro-4-methoxyphenyl)methyl]-N-[4-(4-methylpiperidin-1-yl)phenyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(CN2CCN(C(=O)Nc3ccc(N4CCC(C)CC4)cc3)CC2)cc1F |
| InChI | InChI=1S/C25H33FN4O2/c1-19-9-11-29(12-10-19)22-6-4-21(5-7-22)27-25(31)30-15-13-28(14-16-30)18-20-3-8-24(32-2)23(26)17-20/h3-8,17,19H,9-16,18H2,1-2H3,(H,27,31) |
| InChIKey | ZJMKKLULWHREID-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|