C18H27NO3 — CID 78875889
N-benzyl-3-(oxolan-2-ylmethoxy)-N-propylpropanamide (PubChem CID 78875889) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is N-benzyl-3-(oxolan-2-ylmethoxy)-N-propylpropanamide.
| Compound Name | N-benzyl-3-(oxolan-2-ylmethoxy)-N-propylpropanamide |
|---|---|
| PubChem CID | 78875889 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | N-benzyl-3-(oxolan-2-ylmethoxy)-N-propylpropanamide |
| SMILES | CCCN(Cc1ccccc1)C(=O)CCOCC1CCCO1 |
| InChI | InChI=1S/C18H27NO3/c1-2-11-19(14-16-7-4-3-5-8-16)18(20)10-13-21-15-17-9-6-12-22-17/h3-5,7-8,17H,2,6,9-15H2,1H3 |
| InChIKey | KFWNNKPYRFZPHS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|