C25H31NO3 — CID 55991521
N-(2,3-dihydro-1H-inden-1-yl)-N-[(4-methylphenyl)methyl]-3-(oxolan-2-ylmethoxy)propanamide (PubChem CID 55991521) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-1-yl)-N-[(4-methylphenyl)methyl]-3-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-(2,3-dihydro-1H-inden-1-yl)-N-[(4-methylphenyl)methyl]-3-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 55991521 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-1-yl)-N-[(4-methylphenyl)methyl]-3-(oxolan-2-ylmethoxy)propanamide |
| SMILES | Cc1ccc(CN(C(=O)CCOCC2CCCO2)C2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C25H31NO3/c1-19-8-10-20(11-9-19)17-26(24-13-12-21-5-2-3-7-23(21)24)25(27)14-16-28-18-22-6-4-15-29-22/h2-3,5,7-11,22,24H,4,6,12-18H2,1H3 |
| InChIKey | HQAVPTVSHBWPDC-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|