C20H19N3O3S2 — CID 78877366
N-[4-(cyclopropylmethylsulfamoyl)phenyl]-2-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 78877366) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[4-(cyclopropylmethylsulfamoyl)phenyl]-2-phenyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[4-(cyclopropylmethylsulfamoyl)phenyl]-2-phenyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 78877366 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-[4-(cyclopropylmethylsulfamoyl)phenyl]-2-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCC2CC2)cc1)c1cnc(-c2ccccc2)s1 |
| InChI | InChI=1S/C20H19N3O3S2/c24-19(18-13-21-20(27-18)15-4-2-1-3-5-15)23-16-8-10-17(11-9-16)28(25,26)22-12-14-6-7-14/h1-5,8-11,13-14,22H,6-7,12H2,(H,23,24) |
| InChIKey | MFMKDUIRSDMEML-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |