C21H18N4O3S — CID 78878510
N-[3-(benzenesulfonamido)phenyl]-5-methyl-1H-indazole-3-carboxamide (PubChem CID 78878510) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is N-[3-(benzenesulfonamido)phenyl]-5-methyl-1H-indazole-3-carboxamide.
| Compound Name | N-[3-(benzenesulfonamido)phenyl]-5-methyl-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 78878510 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-[3-(benzenesulfonamido)phenyl]-5-methyl-1H-indazole-3-carboxamide |
| SMILES | Cc1ccc2[nH]nc(C(=O)Nc3cccc(NS(=O)(=O)c4ccccc4)c3)c2c1 |
| InChI | InChI=1S/C21H18N4O3S/c1-14-10-11-19-18(12-14)20(24-23-19)21(26)22-15-6-5-7-16(13-15)25-29(27,28)17-8-3-2-4-9-17/h2-13,25H,1H3,(H,22,26)(H,23,24) |
| InChIKey | GBFUPZQZILVPFM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |