C15H19IN2O3 — CID 78880040
2-iodo-N,3-dimethyl-N-(2-morpholin-4-yl-2-oxoethyl)benzamide (PubChem CID 78880040) has the molecular formula C15H19IN2O3 and a molecular weight of 402.23 g/mol. Its IUPAC name is 2-iodo-N,3-dimethyl-N-(2-morpholin-4-yl-2-oxoethyl)benzamide.
| Compound Name | 2-iodo-N,3-dimethyl-N-(2-morpholin-4-yl-2-oxoethyl)benzamide |
|---|---|
| PubChem CID | 78880040 |
| Molecular Formula | C15H19IN2O3 |
| Molecular Weight | 402.23 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | 2-iodo-N,3-dimethyl-N-(2-morpholin-4-yl-2-oxoethyl)benzamide |
| SMILES | Cc1cccc(C(=O)N(C)CC(=O)N2CCOCC2)c1I |
| InChI | InChI=1S/C15H19IN2O3/c1-11-4-3-5-12(14(11)16)15(20)17(2)10-13(19)18-6-8-21-9-7-18/h3-5H,6-10H2,1-2H3 |
| InChIKey | FHMAABYIUUCBCM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|