C16H14F2N2O4S2 — CID 78881193
N-(3-cyanophenyl)-N-[[4-(difluoromethylsulfonyl)phenyl]methyl]methanesulfonamide (PubChem CID 78881193) has the molecular formula C16H14F2N2O4S2 and a molecular weight of 400.43 g/mol. Its IUPAC name is N-(3-cyanophenyl)-N-[[4-(difluoromethylsulfonyl)phenyl]methyl]methanesulfonamide.
| Compound Name | N-(3-cyanophenyl)-N-[[4-(difluoromethylsulfonyl)phenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 78881193 |
| Molecular Formula | C16H14F2N2O4S2 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | N-(3-cyanophenyl)-N-[[4-(difluoromethylsulfonyl)phenyl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1ccc(S(=O)(=O)C(F)F)cc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C16H14F2N2O4S2/c1-25(21,22)20(14-4-2-3-13(9-14)10-19)11-12-5-7-15(8-6-12)26(23,24)16(17)18/h2-9,16H,11H2,1H3 |
| InChIKey | AZNIYLNVUWRQEL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 95.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |