C23H24N4O3S — CID 78884328
ethyl 5-phenyl-2-[(1-pyrimidin-2-ylpiperidine-4-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 78884328) has the molecular formula C23H24N4O3S and a molecular weight of 436.54 g/mol. Its IUPAC name is ethyl 5-phenyl-2-[(1-pyrimidin-2-ylpiperidine-4-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-phenyl-2-[(1-pyrimidin-2-ylpiperidine-4-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 78884328 |
| Molecular Formula | C23H24N4O3S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | ethyl 5-phenyl-2-[(1-pyrimidin-2-ylpiperidine-4-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=O)C1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C23H24N4O3S/c1-2-30-22(29)18-15-19(16-7-4-3-5-8-16)31-21(18)26-20(28)17-9-13-27(14-10-17)23-24-11-6-12-25-23/h3-8,11-12,15,17H,2,9-10,13-14H2,1H3,(H,26,28) |
| InChIKey | YOFYODUYYKSVOM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |