C19H27ClN2O4S — CID 78884804
1-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-2-cyclopentylsulfonylethanone (PubChem CID 78884804) has the molecular formula C19H27ClN2O4S and a molecular weight of 414.96 g/mol. Its IUPAC name is 1-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-2-cyclopentylsulfonylethanone.
| Compound Name | 1-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-2-cyclopentylsulfonylethanone |
|---|---|
| PubChem CID | 78884804 |
| Molecular Formula | C19H27ClN2O4S |
| Molecular Weight | 414.96 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-2-cyclopentylsulfonylethanone |
| SMILES | O=C(CS(=O)(=O)C1CCCC1)N1CCN(CCOc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H27ClN2O4S/c20-16-5-7-17(8-6-16)26-14-13-21-9-11-22(12-10-21)19(23)15-27(24,25)18-3-1-2-4-18/h5-8,18H,1-4,9-15H2 |
| InChIKey | CKWKUAPFHLFLHQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.96 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |