C15H25F3N4O2 — CID 78885859
1-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]urea (PubChem CID 78885859) has the molecular formula C15H25F3N4O2 and a molecular weight of 350.39 g/mol. Its IUPAC name is 1-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]urea.
| Compound Name | 1-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 78885859 |
| Molecular Formula | C15H25F3N4O2 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 1-[3-(2-oxopyrrolidin-1-yl)propyl]-3-[[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]methyl]urea |
| SMILES | O=C(NCCCN1CCCC1=O)NCC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C15H25F3N4O2/c16-15(17,18)11-21-8-4-12(10-21)9-20-14(24)19-5-2-7-22-6-1-3-13(22)23/h12H,1-11H2,(H2,19,20,24) |
| InChIKey | PYEDWEIDPLMHGC-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|