C10H9Cl2N3OS2 — CID 78887150
2,2-dichloro-N-[5-(cyanomethylsulfanyl)-4-methyl-1,3-thiazol-2-yl]cyclopropane-1-carboxamide (PubChem CID 78887150) has the molecular formula C10H9Cl2N3OS2 and a molecular weight of 322.24 g/mol. Its IUPAC name is 2,2-dichloro-N-[5-(cyanomethylsulfanyl)-4-methyl-1,3-thiazol-2-yl]cyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-[5-(cyanomethylsulfanyl)-4-methyl-1,3-thiazol-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 78887150 |
| Molecular Formula | C10H9Cl2N3OS2 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 2,2-dichloro-N-[5-(cyanomethylsulfanyl)-4-methyl-1,3-thiazol-2-yl]cyclopropane-1-carboxamide |
| SMILES | Cc1nc(NC(=O)C2CC2(Cl)Cl)sc1SCC#N |
| InChI | InChI=1S/C10H9Cl2N3OS2/c1-5-8(17-3-2-13)18-9(14-5)15-7(16)6-4-10(6,11)12/h6H,3-4H2,1H3,(H,14,15,16) |
| InChIKey | ZRTKKYIBIBEIPE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|