C25H21N3O3 — CID 78887491
6-methoxy-N-[2-methyl-5-(phenylcarbamoyl)phenyl]quinoline-2-carboxamide (PubChem CID 78887491) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is 6-methoxy-N-[2-methyl-5-(phenylcarbamoyl)phenyl]quinoline-2-carboxamide.
| Compound Name | 6-methoxy-N-[2-methyl-5-(phenylcarbamoyl)phenyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 78887491 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 6-methoxy-N-[2-methyl-5-(phenylcarbamoyl)phenyl]quinoline-2-carboxamide |
| SMILES | COc1ccc2nc(C(=O)Nc3cc(C(=O)Nc4ccccc4)ccc3C)ccc2c1 |
| InChI | InChI=1S/C25H21N3O3/c1-16-8-9-18(24(29)26-19-6-4-3-5-7-19)15-23(16)28-25(30)22-12-10-17-14-20(31-2)11-13-21(17)27-22/h3-15H,1-2H3,(H,26,29)(H,28,30) |
| InChIKey | AEMNKZNXJGXFDJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |