C17H24N4O2 — CID 78888249
3-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-1-cyclopropyl-1-(2-hydroxyethyl)urea (PubChem CID 78888249) has the molecular formula C17H24N4O2 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-1-cyclopropyl-1-(2-hydroxyethyl)urea.
| Compound Name | 3-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-1-cyclopropyl-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 78888249 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 3-[1-(1H-benzimidazol-2-yl)-2-methylpropyl]-1-cyclopropyl-1-(2-hydroxyethyl)urea |
| SMILES | CC(C)C(NC(=O)N(CCO)C1CC1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H24N4O2/c1-11(2)15(16-18-13-5-3-4-6-14(13)19-16)20-17(23)21(9-10-22)12-7-8-12/h3-6,11-12,15,22H,7-10H2,1-2H3,(H,18,19)(H,20,23) |
| InChIKey | UBXZMYIRUJPEEH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |