C21H24N6O2S — CID 78888744
1-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)-3-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]urea (PubChem CID 78888744) has the molecular formula C21H24N6O2S and a molecular weight of 424.53 g/mol. Its IUPAC name is 1-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)-3-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]urea.
| Compound Name | 1-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)-3-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 78888744 |
| Molecular Formula | C21H24N6O2S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophene-2-carbonylamino)-3-[1-[4-(1,2,4-triazol-1-yl)phenyl]ethyl]urea |
| SMILES | CC(NC(=O)NNC(=O)c1cc2c(s1)CCCCC2)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C21H24N6O2S/c1-14(15-7-9-17(10-8-15)27-13-22-12-23-27)24-21(29)26-25-20(28)19-11-16-5-3-2-4-6-18(16)30-19/h7-14H,2-6H2,1H3,(H,25,28)(H2,24,26,29) |
| InChIKey | XFLFDCXIKBGFJZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|