C22H27ClN2O3S — CID 78888779
2-chloro-N-cyclopropyl-N-(3-methylbutyl)-5-[methyl(phenyl)sulfamoyl]benzamide (PubChem CID 78888779) has the molecular formula C22H27ClN2O3S and a molecular weight of 434.99 g/mol. Its IUPAC name is 2-chloro-N-cyclopropyl-N-(3-methylbutyl)-5-[methyl(phenyl)sulfamoyl]benzamide.
| Compound Name | 2-chloro-N-cyclopropyl-N-(3-methylbutyl)-5-[methyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 78888779 |
| Molecular Formula | C22H27ClN2O3S |
| Molecular Weight | 434.99 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-chloro-N-cyclopropyl-N-(3-methylbutyl)-5-[methyl(phenyl)sulfamoyl]benzamide |
| SMILES | CC(C)CCN(C(=O)c1cc(S(=O)(=O)N(C)c2ccccc2)ccc1Cl)C1CC1 |
| InChI | InChI=1S/C22H27ClN2O3S/c1-16(2)13-14-25(18-9-10-18)22(26)20-15-19(11-12-21(20)23)29(27,28)24(3)17-7-5-4-6-8-17/h4-8,11-12,15-16,18H,9-10,13-14H2,1-3H3 |
| InChIKey | FUKZZUFEZCKIJH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.99 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |