C21H20N2O4S — CID 78889031
ethyl 2-[2-[N-(furan-2-ylmethyl)anilino]-2-oxoethyl]sulfanylpyridine-3-carboxylate (PubChem CID 78889031) has the molecular formula C21H20N2O4S and a molecular weight of 396.47 g/mol. Its IUPAC name is ethyl 2-[2-[N-(furan-2-ylmethyl)anilino]-2-oxoethyl]sulfanylpyridine-3-carboxylate.
| Compound Name | ethyl 2-[2-[N-(furan-2-ylmethyl)anilino]-2-oxoethyl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 78889031 |
| Molecular Formula | C21H20N2O4S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | ethyl 2-[2-[N-(furan-2-ylmethyl)anilino]-2-oxoethyl]sulfanylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1SCC(=O)N(Cc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C21H20N2O4S/c1-2-26-21(25)18-11-6-12-22-20(18)28-15-19(24)23(14-17-10-7-13-27-17)16-8-4-3-5-9-16/h3-13H,2,14-15H2,1H3 |
| InChIKey | SDPBJVNXWQMEPT-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |