C17H21F3N2O2S — CID 78889326
1-(2-methylpropanoyl)-N-[2-(trifluoromethylsulfanyl)phenyl]piperidine-4-carboxamide (PubChem CID 78889326) has the molecular formula C17H21F3N2O2S and a molecular weight of 374.43 g/mol. Its IUPAC name is 1-(2-methylpropanoyl)-N-[2-(trifluoromethylsulfanyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-methylpropanoyl)-N-[2-(trifluoromethylsulfanyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78889326 |
| Molecular Formula | C17H21F3N2O2S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-(2-methylpropanoyl)-N-[2-(trifluoromethylsulfanyl)phenyl]piperidine-4-carboxamide |
| SMILES | CC(C)C(=O)N1CCC(C(=O)Nc2ccccc2SC(F)(F)F)CC1 |
| InChI | InChI=1S/C17H21F3N2O2S/c1-11(2)16(24)22-9-7-12(8-10-22)15(23)21-13-5-3-4-6-14(13)25-17(18,19)20/h3-6,11-12H,7-10H2,1-2H3,(H,21,23) |
| InChIKey | RFXGSFATZSUTTI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |