C15H15BrFN3O2 — CID 78891451
1-(2-bromo-4-fluoroanilino)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea (PubChem CID 78891451) has the molecular formula C15H15BrFN3O2 and a molecular weight of 368.21 g/mol. Its IUPAC name is 1-(2-bromo-4-fluoroanilino)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea.
| Compound Name | 1-(2-bromo-4-fluoroanilino)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea |
|---|---|
| PubChem CID | 78891451 |
| Molecular Formula | C15H15BrFN3O2 |
| Molecular Weight | 368.21 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 1-(2-bromo-4-fluoroanilino)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea |
| SMILES | O=C(NNc1ccc(F)cc1Br)NC1CCCc2occc21 |
| InChI | InChI=1S/C15H15BrFN3O2/c16-11-8-9(17)4-5-13(11)19-20-15(21)18-12-2-1-3-14-10(12)6-7-22-14/h4-8,12,19H,1-3H2,(H2,18,20,21) |
| InChIKey | UWWSJSUBLCDJSX-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.21 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|