C18H33N3O2 — CID 78892210
4-[2-(2-bicyclo[2.2.1]heptanyl)ethylcarbamoylamino]-N,N-diethylbutanamide (PubChem CID 78892210) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is 4-[2-(2-bicyclo[2.2.1]heptanyl)ethylcarbamoylamino]-N,N-diethylbutanamide.
| Compound Name | 4-[2-(2-bicyclo[2.2.1]heptanyl)ethylcarbamoylamino]-N,N-diethylbutanamide |
|---|---|
| PubChem CID | 78892210 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | 4-[2-(2-bicyclo[2.2.1]heptanyl)ethylcarbamoylamino]-N,N-diethylbutanamide |
| SMILES | CCN(CC)C(=O)CCCNC(=O)NCCC1CC2CCC1C2 |
| InChI | InChI=1S/C18H33N3O2/c1-3-21(4-2)17(22)6-5-10-19-18(23)20-11-9-16-13-14-7-8-15(16)12-14/h14-16H,3-13H2,1-2H3,(H2,19,20,23) |
| InChIKey | RMTBEGBQQYFTPM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|